| product Name |
p-Aminoazobenzene |
| Synonyms |
C.I. 11000; C.I. Solvent Yellow 1; C.I. Solvent Yellow 1 (8CI); Aniline Yellow; 4-phenylazoaniline; Phenylazoaniline,95%; 4-Aminoazobenzene; Solvent Yellow 1; 4-Benzeneazoaniline; Azobenzene, 4-amino-; Oil Yellow AAB; 4-[(E)-phenyldiazenyl]aniline; (1E)-1-phenyltriaz-1-ene; 4-[(Z)-phenyldiazenyl]aniline; 4-(phenyldiazenyl)aniline |
| Molecular Formula |
C12H11N3 |
| Molecular Weight |
197.2358 |
| InChI |
InChI=1/C12H11N3/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,13H2 |
| CAS Registry Number |
60-09-3 |
| EINECS |
200-453-6 |
| Molecular Structure |
|
| Density |
1.127g/cm3 |
| Boiling point |
360.658°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
171.92°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|