| product Name |
9,9'-Bianthracene |
| Synonyms |
9,9'-Bianthryl; AI3-19380; 9-(9-Anthryl)anthracene |
| Molecular Formula |
C28H18 |
| Molecular Weight |
354.4425 |
| InChI |
InChI=1/C28H18/c1-5-13-23-19(9-1)17-20-10-2-6-14-24(20)27(23)28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28/h1-18H |
| CAS Registry Number |
1055-23-8 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
523.8°C at 760 mmHg |
| Refractive index |
1.78 |
| Flash point |
268.2°C |
| Vapour Pressur |
1.53E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|