product Name |
trans-1,2-Dibenzoylethylene |
Synonyms |
trans-1,4-Diphenyl-2-butene-1,4-dione; 1,2-Dibenzoylethylene, perdominantly trans, (trans-1,4-Diphenyl-2-butene-1,4-dione); (2E)-1,4-diphenylbut-2-ene-1,4-dione |
Molecular Formula |
C16H12O2 |
Molecular Weight |
236.2653 |
InChI |
InChI=1/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
CAS Registry Number |
959-28-4 |
EINECS |
213-498-1 |
Molecular Structure |
|
Density |
1.141g/cm3 |
Melting point |
108-112℃ |
Boiling point |
368.5°C at 760 mmHg |
Refractive index |
1.597 |
Flash point |
138.2°C |
Vapour Pressur |
1.27E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|