| product Name |
trans-1,2-Dibenzoylethylene |
| Synonyms |
trans-1,4-Diphenyl-2-butene-1,4-dione; 1,2-Dibenzoylethylene, perdominantly trans, (trans-1,4-Diphenyl-2-butene-1,4-dione); (2E)-1,4-diphenylbut-2-ene-1,4-dione |
| Molecular Formula |
C16H12O2 |
| Molecular Weight |
236.2653 |
| InChI |
InChI=1/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| CAS Registry Number |
959-28-4 |
| EINECS |
213-498-1 |
| Molecular Structure |
|
| Density |
1.141g/cm3 |
| Melting point |
108-112℃ |
| Boiling point |
368.5°C at 760 mmHg |
| Refractive index |
1.597 |
| Flash point |
138.2°C |
| Vapour Pressur |
1.27E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
