product Name |
3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine |
Synonyms |
5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine~PDT; PDT; 5,6-diphenyl-3-(pyridin-2-yl)-1,2,4-triazine |
Molecular Formula |
C20H14N4 |
Molecular Weight |
310.352 |
InChI |
InChI=1/C20H14N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(22-18)17-13-7-8-14-21-17/h1-14H |
CAS Registry Number |
1046-56-6 |
EINECS |
213-878-7 |
Molecular Structure |
|
Density |
1.202g/cm3 |
Melting point |
191-193℃ |
Boiling point |
525.3°C at 760 mmHg |
Refractive index |
1.634 |
Flash point |
237.7°C |
Vapour Pressur |
1.33E-10mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|