| product Name |
3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine |
| Synonyms |
5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine~PDT; PDT; 5,6-diphenyl-3-(pyridin-2-yl)-1,2,4-triazine |
| Molecular Formula |
C20H14N4 |
| Molecular Weight |
310.352 |
| InChI |
InChI=1/C20H14N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(22-18)17-13-7-8-14-21-17/h1-14H |
| CAS Registry Number |
1046-56-6 |
| EINECS |
213-878-7 |
| Molecular Structure |
|
| Density |
1.202g/cm3 |
| Melting point |
191-193℃ |
| Boiling point |
525.3°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
237.7°C |
| Vapour Pressur |
1.33E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|