product Name |
3,5-Dinitro-4-hydroxybenzoic acid |
Synonyms |
4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate |
Molecular Formula |
C7H2N2O7 |
Molecular Weight |
226.1011 |
InChI |
InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2 |
CAS Registry Number |
1019-52-9 |
EINECS |
213-814-8 |
Molecular Structure |
|
Melting point |
249-252℃ |
Boiling point |
349.4°C at 760 mmHg |
Flash point |
155.7°C |
Vapour Pressur |
1.76E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|