| product Name |
2,3-DICYANO-1,4-NAPHTHOQUINONE |
| Synonyms |
2,3-Naphthalenedicarbonitrile, 1,4-dihydro-1,4-dioxo-; NSC 146588; 1,4-dioxo-1,4-dihydronaphthalene-2,3-dicarbonitrile |
| Molecular Formula |
C12H4N2O2 |
| Molecular Weight |
208.1724 |
| InChI |
InChI=1/C12H4N2O2/c13-5-9-10(6-14)12(16)8-4-2-1-3-7(8)11(9)15/h1-4H |
| CAS Registry Number |
1018-78-6 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Boiling point |
334.9°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
156.4°C |
| Vapour Pressur |
0.000124mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|