product Name |
3,4,5-trimethoxyphenyl isocyanate |
Synonyms |
-; 5-isocyanato-1,2,3-trimethoxybenzene |
Molecular Formula |
C10H11NO4 |
Molecular Weight |
209.1986 |
InChI |
InChI=1/C10H11NO4/c1-13-8-4-7(11-6-12)5-9(14-2)10(8)15-3/h4-5H,1-3H3 |
CAS Registry Number |
1016-19-9 |
Molecular Structure |
|
Density |
1.13g/cm3 |
Melting point |
42-45℃ |
Boiling point |
318.8°C at 760 mmHg |
Refractive index |
1.494 |
Flash point |
148.5°C |
Vapour Pressur |
0.000353mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|