product Name |
Dibenzothiophene sulfone |
Synonyms |
Dibenzothiophene-5,5-dioxide; dibenzo[b,d]thiophene 5,5-dioxide |
Molecular Formula |
C12H8O2S |
Molecular Weight |
216.2557 |
InChI |
InChI=1/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
CAS Registry Number |
1016-05-3 |
EINECS |
213-805-9 |
Molecular Structure |
|
Density |
1.396g/cm3 |
Melting point |
231-236℃ |
Boiling point |
422.2°C at 760 mmHg |
Refractive index |
1.675 |
Flash point |
275.7°C |
Vapour Pressur |
6.03E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|