| product Name |
2-(5H-purin-6-yl)acetamide |
| Synonyms |
|
| Molecular Formula |
C7H7N5O |
| Molecular Weight |
177.1634 |
| InChI |
InChI=1/C7H7N5O/c8-5(13)1-4-6-7(11-2-9-4)12-3-10-6/h2-3,6H,1H2,(H2,8,13) |
| CAS Registry Number |
2228-05-9 |
| Molecular Structure |
|
| Density |
1.75g/cm3 |
| Boiling point |
421.9°C at 760 mmHg |
| Refractive index |
1.837 |
| Flash point |
209°C |
| Vapour Pressur |
2.52E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|