| product Name |
3-(4-methoxyphenyl)prop-2-ynoic acid |
| Synonyms |
2-propynoic acid, 3-(4-methoxyphenyl)- |
| Molecular Formula |
C10H8O3 |
| Molecular Weight |
176.1687 |
| InChI |
InChI=1/C10H8O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-3,5-6H,1H3,(H,11,12) |
| CAS Registry Number |
2227-57-8 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Boiling point |
340.9°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
139.1°C |
| Vapour Pressur |
3.21E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|