| product Name |
(S)-4-methyloxazolidine-2,5-dione |
| Synonyms |
(S)-4-Methyloxazolidine-2,5-dione; (4S)-4-methyl-1,3-oxazolidine-2,5-dione |
| Molecular Formula |
C4H5NO3 |
| Molecular Weight |
115.0874 |
| InChI |
InChI=1/C4H5NO3/c1-2-3(6)8-4(7)5-2/h2H,1H3,(H,5,7)/t2-/m0/s1 |
| CAS Registry Number |
2224-52-4 |
| EINECS |
218-750-4 |
| Molecular Structure |
|
| Density |
1.296g/cm3 |
| Refractive index |
1.448 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|