| product Name |
3-methyl-1-nitrobutan-2-ol |
| Synonyms |
|
| Molecular Formula |
C5H11NO3 |
| Molecular Weight |
133.1457 |
| InChI |
InChI=1/C5H11NO3/c1-4(2)5(7)3-6(8)9/h4-5,7H,3H2,1-2H3 |
| CAS Registry Number |
2224-38-6 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Boiling point |
215.8°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
94.3°C |
| Vapour Pressur |
0.0314mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|