| product Name |
4-(but-2-en-1-yl)-1,2-diphenylpyrazolidine-3,5-dione |
| Synonyms |
|
| Molecular Formula |
C19H18N2O2 |
| Molecular Weight |
306.3584 |
| InChI |
InChI=1/C19H18N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h2-13,17H,14H2,1H3 |
| CAS Registry Number |
2224-07-9 |
| Molecular Structure |
|
| Density |
1.194g/cm3 |
| Boiling point |
425.4°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
176.4°C |
| Vapour Pressur |
1.92E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|