| product Name |
9,10-dihydrophenanthrene-9-carboxylic acid |
| Synonyms |
|
| Molecular Formula |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-8,14H,9H2,(H,16,17) |
| CAS Registry Number |
2222-30-2 |
| Molecular Structure |
|
| Density |
1.257g/cm3 |
| Boiling point |
428.8°C at 760 mmHg |
| Refractive index |
1.643 |
| Flash point |
193.1°C |
| Vapour Pressur |
4.08E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|