| product Name |
2,2',6,6'-tetranitrobiphenyl |
| Synonyms |
1,1'-Biphenyl, 2,2',6,6'-tetranitro-; 2,2',6,6'-Tetranitro-1,1'-biphenyl |
| Molecular Formula |
C12H6N4O8 |
| Molecular Weight |
334.198 |
| InChI |
InChI=1/C12H6N4O8/c17-13(18)7-3-1-4-8(14(19)20)11(7)12-9(15(21)22)5-2-6-10(12)16(23)24/h1-6H |
| CAS Registry Number |
2217-54-1 |
| Molecular Structure |
|
| Density |
1.653g/cm3 |
| Boiling point |
464.1°C at 760 mmHg |
| Refractive index |
1.687 |
| Flash point |
225.1°C |
| Vapour Pressur |
2.38E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|