| product Name |
1,2,3,4-Tetrahydro-1-naphthylamine |
| Synonyms |
1-Aminotetralin; 1-Amino-1,2,3,4-tetrahydronaphthalene; 1,2,3,4-tetrahydronaphthalen-1-amine; N-(phenylacetyl)glycine; (1R)-1,2,3,4-tetrahydronaphthalen-1-aminium; (1S)-1,2,3,4-tetrahydronaphthalen-1-aminium |
| Molecular Formula |
C10H14N |
| Molecular Weight |
148.2243 |
| InChI |
InChI=1/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2/p+1/t10-/m0/s1 |
| CAS Registry Number |
2217-40-5 |
| EINECS |
218-712-7 |
| Molecular Structure |
|
| Boiling point |
249.6°C at 760 mmHg |
| Flash point |
110.8°C |
| Vapour Pressur |
0.0228mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|