| product Name |
ethyl N-phenylglycinate |
| Synonyms |
Glycine, N-phenyl-, ethyl ester; AI3-09020; Ethyl N-phenylglycinate; N-phenylglycine ethyl ester; ethyl 2-anilinoacetate |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-2-13-10(12)8-11-9-6-4-3-5-7-9/h3-7,11H,2,8H2,1H3 |
| CAS Registry Number |
2216-92-4 |
| EINECS |
218-702-2 |
| Molecular Structure |
|
| Density |
1.107g/cm3 |
| Boiling point |
274.2°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
119.6°C |
| Vapour Pressur |
0.00549mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|