| product Name |
heptyl propionate |
| Synonyms |
Heptyl propionate; AI3-21504; Propanoic acid, heptyl ester; heptyl propanoate |
| Molecular Formula |
C10H20O2 |
| Molecular Weight |
172.2646 |
| InChI |
InChI=1/C10H20O2/c1-3-5-6-7-8-9-12-10(11)4-2/h3-9H2,1-2H3 |
| CAS Registry Number |
2216-81-1 |
| EINECS |
218-698-2 |
| Molecular Structure |
|
| Density |
0.874g/cm3 |
| Boiling point |
209.7°C at 760 mmHg |
| Refractive index |
1.422 |
| Flash point |
79.8°C |
| Vapour Pressur |
0.2mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|