| product Name |
N-methylnaphthalen-2-amine |
| Synonyms |
2-naphthalenamine, N-methyl-; N-Methyl-2-naphthalenamine; N-methyl-N-2-naphthylamine; N-Methylnaphthalen-2-amine |
| Molecular Formula |
C11H11N |
| Molecular Weight |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-8,12H,1H3 |
| CAS Registry Number |
2216-67-3 |
| Molecular Structure |
|
| Density |
1.099g/cm3 |
| Boiling point |
317°C at 760 mmHg |
| Refractive index |
1.674 |
| Flash point |
149.7°C |
| Vapour Pressur |
0.000396mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|