| product Name |
[1R-(1α,2β,5α)]-2-(isopropyl)-5-methylcyclohexylamine |
| Synonyms |
(1R-(1alpha,2beta,5alpha))-2-(Isopropyl)-5-methylcyclohexylamine; 5-methyl-2-(propan-2-yl)cyclohexanamine; (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanamine |
| Molecular Formula |
C10H21N |
| Molecular Weight |
155.2804 |
| InChI |
InChI=1/C10H21N/c1-7(2)9-5-4-8(3)6-10(9)11/h7-10H,4-6,11H2,1-3H3/t8-,9+,10-/m1/s1 |
| CAS Registry Number |
2216-54-8 |
| EINECS |
218-693-5 |
| Molecular Structure |
|
| Density |
0.834g/cm3 |
| Boiling point |
192.8°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
45.8°C |
| Vapour Pressur |
0.479mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|