| product Name |
7-methyl-2-benzofuran-1(3H)-one |
| Synonyms |
1(3H)-isobenzofuranone, 7-methyl-; 7-Methyl-2-benzofuran-1(3H)-one |
| Molecular Formula |
C9H8O2 |
| Molecular Weight |
148.1586 |
| InChI |
InChI=1/C9H8O2/c1-6-3-2-4-7-5-11-9(10)8(6)7/h2-4H,5H2,1H3 |
| CAS Registry Number |
2211-84-9 |
| Molecular Structure |
|
| Density |
1.211g/cm3 |
| Boiling point |
326.6°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
134.9°C |
| Vapour Pressur |
0.000213mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|