| 
  
    | product Name | 6-phenyl-5-[3-(phenylamino)propyl]pyrimidine-2,4-diamine |  
    | Synonyms |  |  
    | Molecular Formula | C19H21N5 |  
    | Molecular Weight | 319.4035 |  
    | InChI | InChI=1/C19H21N5/c20-18-16(12-7-13-22-15-10-5-2-6-11-15)17(23-19(21)24-18)14-8-3-1-4-9-14/h1-6,8-11,22H,7,12-13H2,(H4,20,21,23,24) |  
    | CAS Registry Number | 2211-01-0 |  
    | Molecular Structure | ![2211-01-0 6-phenyl-5-[3-(phenylamino)propyl]pyrimidine-2,4-diamine](http://images-a.chemnet.com/suppliers/chembase/cas71/2211-01-0.png)  |  
    | Density | 1.233g/cm3 |  
    | Boiling point | 651.8°C at 760 mmHg |  
    | Refractive index | 1.689 |  
    | Flash point | 348°C |  
    | Vapour Pressur | 7.15E-17mmHg at 25°C |  
    | Hazard Symbols |  |  
    | Risk Codes |  |  
    | Safety Description |  |  |