| product Name |
o-Cresyl glycidyl ether |
| Synonyms |
Glycidyl 2-methylphenyl ether; 2,3-epoxypropyl o-tolyl ether; Glycidyl-(o-tolyl)-ether; Glycidyl o-cresyl ether~Glycidyl 2-methylphenyl ether; 2-[(2-methylphenoxy)methyl]oxirane; (2R)-2-[(2-methylphenoxy)methyl]oxirane; (2S)-2-[(2-methylphenoxy)methyl]oxirane; 2-Methylphenyl Glycidyl ether |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9/h2-5,9H,6-7H2,1H3/t9-/m0/s1 |
| CAS Registry Number |
2210-79-9 |
| EINECS |
218-645-3 |
| Molecular Structure |
|
| Density |
1.094g/cm3 |
| Boiling point |
268°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
99.2°C |
| Vapour Pressur |
0.013mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|