| product Name |
5-methylazepan-2-one |
| Synonyms |
2H-Azepin-2-one, hexahydro-5-methyl- |
| Molecular Formula |
C7H13NO |
| Molecular Weight |
127.1842 |
| InChI |
InChI=1/C7H13NO/c1-6-2-3-7(9)8-5-4-6/h6H,2-5H2,1H3,(H,8,9) |
| CAS Registry Number |
2210-07-3 |
| Molecular Structure |
|
| Density |
0.93g/cm3 |
| Boiling point |
269.3°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
150.7°C |
| Vapour Pressur |
0.00733mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|