| product Name |
1-(p-tolyl)-3-(p-tolylcarbamothioylamino)thiourea |
| Synonyms |
|
| Molecular Formula |
C16H18N4S2 |
| Molecular Weight |
330.4709 |
| InChI |
InChI=1/C16H18N4S2/c1-11-3-7-13(8-4-11)17-15(21)19-20-16(22)18-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,17,19,21)(H2,18,20,22) |
| CAS Registry Number |
2209-25-8 |
| Molecular Structure |
|
| Density |
1.325g/cm3 |
| Boiling point |
456.3°C at 760 mmHg |
| Refractive index |
1.744 |
| Flash point |
229.7°C |
| Vapour Pressur |
1.64E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|