| product Name |
[2-methyl-2-(4-methylphenyl)-1,3-dioxolan-4-yl]methanol |
| Synonyms |
|
| Molecular Formula |
C12H16O3 |
| Molecular Weight |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-9-3-5-10(6-4-9)12(2)14-8-11(7-13)15-12/h3-6,11,13H,7-8H2,1-2H3 |
| CAS Registry Number |
2208-28-8 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Boiling point |
326.8°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
161.7°C |
| Vapour Pressur |
8.53E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|