| product Name |
[2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methanol |
| Synonyms |
[2-(4-Chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methanol; 1,3-dioxolane-4-methanol, 2-(4-chlorophenyl)-2-ethyl- |
| Molecular Formula |
C12H15ClO3 |
| Molecular Weight |
242.6987 |
| InChI |
InChI=1/C12H15ClO3/c1-2-12(15-8-11(7-14)16-12)9-3-5-10(13)6-4-9/h3-6,11,14H,2,7-8H2,1H3 |
| CAS Registry Number |
2208-27-7 |
| Molecular Structure |
|
| Density |
1.204g/cm3 |
| Boiling point |
349.1°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
164.9°C |
| Vapour Pressur |
1.8E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|