| product Name |
choline benzoate |
| Synonyms |
Benzoylcholine; Choline benzoate; Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-; 2-hydroxy-N,N,N-trimethylethanaminium benzoate |
| Molecular Formula |
C12H19NO3 |
| Molecular Weight |
225.2842 |
| InChI |
InChI=1/C7H6O2.C5H14NO/c8-7(9)6-4-2-1-3-5-6;1-6(2,3)4-5-7/h1-5H,(H,8,9);7H,4-5H2,1-3H3/q;+1/p-1 |
| CAS Registry Number |
2208-04-0 |
| EINECS |
218-629-6 |
| Molecular Structure |
|
| Boiling point |
249.3°C at 760 mmHg |
| Flash point |
111.4°C |
| Vapour Pressur |
0.0122mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|