| product Name |
5-Chlorobenzo-2,1,3-thiadiazole |
| Synonyms |
5-Chloro-2,1,3-benzothiadiazole; NSC 139785 |
| Molecular Formula |
C6H3ClN2S |
| Molecular Weight |
170.6194 |
| InChI |
InChI=1/C6H3ClN2S/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H |
| CAS Registry Number |
2207-32-1 |
| Molecular Structure |
|
| Density |
1.531g/cm3 |
| Boiling point |
248.1°C at 760 mmHg |
| Refractive index |
1.71 |
| Flash point |
103.8°C |
| Vapour Pressur |
0.039mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|