product Name |
(Methyl sulfoxide)-d6 |
Synonyms |
Dimethyl-d6 sulfoxide; (Methyl sulfoxide)-d6 with 0.03% TMS packaged in 0.75 ml ampules; dimethyl sulfoxide 99.9 atom % D; Dimethylsulfoxide-d6; Dimethyl-d6 sulphoxide + 0.05% TMS (v/v); Dimethylsulfoxidedisotopicpurity; Dimethyl sulfoxide-d6; (methylsulfinyl)methane; [(~2~H_3_)methylsulfinyl](~2~H_3_)methane |
Molecular Formula |
C2D6OS |
Molecular Weight |
84.1704 |
InChI |
InChI=1/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
CAS Registry Number |
2206-27-1 |
EINECS |
218-617-0 |
Molecular Structure |
|
Density |
1.184g/cm3 |
Melting point |
20-56℃ |
Boiling point |
189°C at 760 mmHg |
Refractive index |
1.479 |
Flash point |
85°C |
Vapour Pressur |
0.805mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|