| product Name |
4-cyanophenyl (3,4-dichlorophenyl)carbamate |
| Synonyms |
|
| Molecular Formula |
C14H8Cl2N2O2 |
| Molecular Weight |
307.1315 |
| InChI |
InChI=1/C14H8Cl2N2O2/c15-12-6-3-10(7-13(12)16)18-14(19)20-11-4-1-9(8-17)2-5-11/h1-7H,(H,18,19) |
| CAS Registry Number |
2204-77-5 |
| Molecular Structure |
|
| Density |
1.46g/cm3 |
| Boiling point |
438.4°C at 760 mmHg |
| Refractive index |
1.643 |
| Flash point |
218.9°C |
| Vapour Pressur |
6.93E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|