| product Name |
4-methyl-1-(1-phenylcyclohexyl)piperidine hydrochloride (1:1) |
| Synonyms |
1-(1-Phenylcyclohexyl)-4-methylpiperidine hydrochloride |
| Molecular Formula |
C18H28ClN |
| Molecular Weight |
293.8746 |
| InChI |
InChI=1/C18H27N.ClH/c1-16-10-14-19(15-11-16)18(12-6-3-7-13-18)17-8-4-2-5-9-17;/h2,4-5,8-9,16H,3,6-7,10-15H2,1H3;1H |
| CAS Registry Number |
1934-50-5;2201-42-5 |
| Molecular Structure |
|
| Boiling point |
349.5°C at 760 mmHg |
| Flash point |
149.4°C |
| Vapour Pressur |
4.7E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|