| product Name |
1-(2,4-dinitrophenyl)propan-2-one |
| Synonyms |
1-(2,4-Dinitrophenyl)acetone; 2-propanone, 1-(2,4-dinitrophenyl)- |
| Molecular Formula |
C9H8N2O5 |
| Molecular Weight |
224.1702 |
| InChI |
InChI=1/C9H8N2O5/c1-6(12)4-7-2-3-8(10(13)14)5-9(7)11(15)16/h2-3,5H,4H2,1H3 |
| CAS Registry Number |
2200-86-4 |
| Molecular Structure |
|
| Density |
1.404g/cm3 |
| Boiling point |
361.7°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
177.4°C |
| Vapour Pressur |
2.03E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|