product Name |
3-Acetyl-6-bromocoumarin |
Synonyms |
-; 3-acetyl-6-bromo-2H-chromen-2-one |
Molecular Formula |
C11H7BrO3 |
Molecular Weight |
267.0755 |
InChI |
InChI=1/C11H7BrO3/c1-6(13)9-5-7-4-8(12)2-3-10(7)15-11(9)14/h2-5H,1H3 |
CAS Registry Number |
2199-93-1 |
Molecular Structure |
|
Density |
1.643g/cm3 |
Boiling point |
441.3°C at 760 mmHg |
Refractive index |
1.614 |
Flash point |
220.7°C |
Vapour Pressur |
5.51E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|