product Name |
ethyl 4-formyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
Synonyms |
4-Formyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid ethyl ester |
Molecular Formula |
C10H13NO3 |
Molecular Weight |
195.2151 |
InChI |
InChI=1/C10H13NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h5,11H,4H2,1-3H3 |
CAS Registry Number |
2199-64-6 |
Molecular Structure |
|
Density |
1.173g/cm3 |
Melting point |
144℃ |
Boiling point |
347.8°C at 760 mmHg |
Refractive index |
1.556 |
Flash point |
164.1°C |
Vapour Pressur |
5.25E-05mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|