| product Name |
ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate |
| Synonyms |
1H-pyrrole-2-carboxylic acid, 4,5-dimethyl-, ethyl ester; 4,5-Dimethyl-1H-pyrrole-2-carboxylic acid ethyl ester; Ethyl 4,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Formula |
C9H13NO2 |
| Molecular Weight |
167.205 |
| InChI |
InChI=1/C9H13NO2/c1-4-12-9(11)8-5-6(2)7(3)10-8/h5,10H,4H2,1-3H3 |
| CAS Registry Number |
2199-45-3 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
289.7°C at 760 mmHg |
| Refractive index |
1.516 |
| Flash point |
129°C |
| Vapour Pressur |
0.00217mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|