| product Name |
4-Methoxyphenacyl chloride |
| Synonyms |
2-Chloro-1-(4-methoxyphenyl)-1-ethanone; 2-Chloro-4-Methoxyacetophenone; 2-chloro-1-(4-methoxyphenyl)ethanone |
| Molecular Formula |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3 |
| CAS Registry Number |
2196-99-8 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Melting point |
98-100℃ |
| Boiling point |
302.7°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
134.2°C |
| Vapour Pressur |
0.000973mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
|