| product Name |
Glycyl-DL-tryptophan |
| Synonyms |
N-Glycyl-DL-tryptophan; glycyl-L-tryptophan; glycyltryptophan |
| Molecular Formula |
C13H15N3O3 |
| Molecular Weight |
261.2765 |
| InChI |
InChI=1/C13H15N3O3/c14-6-12(17)16-11(13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6,14H2,(H,16,17)(H,18,19) |
| CAS Registry Number |
2189-26-6 |
| EINECS |
218-581-6 |
| Molecular Structure |
|
| Density |
1.383g/cm3 |
| Boiling point |
621.8°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
329.9°C |
| Vapour Pressur |
2.52E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|