product Name |
DL-Alpha-Aminocaprylic acid |
Molecular Formula |
C8H17NO2 |
Molecular Weight |
159.2261 |
InChI |
InChI=1/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)/t7-/m1/s1 |
CAS Registry Number |
2187-07-7 |
EINECS |
218-579-5 |
Molecular Structure |
|
Density |
0.999g/cm3 |
Melting point |
260℃ |
Boiling point |
267.8°C at 760 mmHg |
Refractive index |
1.466 |
Flash point |
115.8°C |
Vapour Pressur |
0.00228mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|