| product Name |
[(m-tolyloxy)methyl]oxirane |
| Synonyms |
((m-Tolyloxy)methyl)oxirane; 2-[(3-methylphenoxy)methyl]oxirane; (2R)-2-[(3-methylphenoxy)methyl]oxirane; (2S)-2-[(3-methylphenoxy)methyl]oxirane |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8-3-2-4-9(5-8)11-6-10-7-12-10/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| CAS Registry Number |
2186-25-6 |
| EINECS |
218-575-3 |
| Molecular Structure |
|
| Density |
1.094g/cm3 |
| Boiling point |
260.6°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
106°C |
| Vapour Pressur |
0.0196mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|