| product Name |
2-{[bis(2-chloroethyl)amino]methyl}-L-phenylalanine |
| Synonyms |
|
| Molecular Formula |
C14H20Cl2N2O2 |
| Molecular Weight |
319.2268 |
| InChI |
InChI=1/C14H20Cl2N2O2/c15-5-7-18(8-6-16)10-12-4-2-1-3-11(12)9-13(17)14(19)20/h1-4,13H,5-10,17H2,(H,19,20)/t13-/m0/s1 |
| CAS Registry Number |
2185-98-0;3734-80-3 |
| Density |
1.277g/cm3 |
| Boiling point |
394.6°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
192.4°C |
| Vapour Pressur |
6.2E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|