| product Name |
4-Chloro-alpha-methylphenylacetonitrile |
| Synonyms |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| Molecular Formula |
C9H8ClN |
| Molecular Weight |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| CAS Registry Number |
2184-88-5 |
| EINECS |
218-569-0 |
| Molecular Structure |
|
| Density |
1.143g/cm3 |
| Boiling point |
260.3°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
104°C |
| Vapour Pressur |
0.0123mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
