| product Name |
ethyl 1-acetyl-4-oxopyrrolidine-3-carboxylate |
| Synonyms |
|
| Molecular Formula |
C9H13NO4 |
| Molecular Weight |
199.2038 |
| InChI |
InChI=1/C9H13NO4/c1-3-14-9(13)7-4-10(6(2)11)5-8(7)12/h7H,3-5H2,1-2H3 |
| CAS Registry Number |
2181-33-1 |
| Molecular Structure |
|
| Density |
1.232g/cm3 |
| Boiling point |
317.9°C at 760 mmHg |
| Refractive index |
1.492 |
| Flash point |
146.1°C |
| Vapour Pressur |
0.000373mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|