| product Name |
methyl 2-methylidenebutanoate |
| Synonyms |
Butanoic acid, 2-methylene-, methyl ester; Butyric acid, 2-methylene-, methyl ester; Methyl 2-ethylacrylate |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-4-5(2)6(7)8-3/h2,4H2,1,3H3 |
| CAS Registry Number |
2177-67-5 |
| Molecular Structure |
|
| Density |
0.906g/cm3 |
| Boiling point |
120.5°C at 760 mmHg |
| Refractive index |
1.409 |
| Flash point |
20.7°C |
| Vapour Pressur |
15.2mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|