| product Name |
Pentachloropyridine |
| Synonyms |
2,3,4,5,6-Pentachlorpyridine; 2,3,4,5,6- Penta chloro pyridine; 2,3,4,5,6-Penta chloro pyridine; 2,3,4,5,6-Pentachloropyridine |
| Molecular Formula |
C5Cl5N |
| Molecular Weight |
251.3252 |
| InChI |
InChI=1/C5Cl5N/c6-1-2(7)4(9)11-5(10)3(1)8 |
| CAS Registry Number |
2176-62-7 |
| EINECS |
218-535-5 |
| Molecular Structure |
|
| Density |
1.764g/cm3 |
| Melting point |
124-126℃ |
| Boiling point |
282.3°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
151.5°C |
| Vapour Pressur |
0.00579mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S24/25:;
|
|