product Name |
Triethanolamine salicylate |
Synonyms |
2-Hydroxybenzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); Benzoic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); TEA-Salicylate; Triethanolamine salicylate; Trolamine salicylate; Mobisyl; Triethanolamine salicylate; Salicylic acid, compound with 2,2',2''-nitrilotriethanol (1:1); 2-hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) |
Molecular Formula |
C13H21NO6 |
Molecular Weight |
287.3089 |
InChI |
InChI=1/C7H6O3.C6H15NO3/c8-6-4-2-1-3-5(6)7(9)10;8-4-1-7(2-5-9)3-6-10/h1-4,8H,(H,9,10);8-10H,1-6H2 |
CAS Registry Number |
2174-16-5 |
EINECS |
218-531-3 |
Molecular Structure |
|
Boiling point |
335.4°C at 760 mmHg |
Flash point |
185°C |
Vapour Pressur |
8.38E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|