| product Name |
octabromooxanthrene |
| Synonyms |
dibenzo[b,e][1,4]dioxin, 1,2,3,4,6,7,8,9-octabromo-; Octabromo-dibenzo-p-dioxin; OCTABROMODIBENZO-P-DIOXIN |
| Molecular Formula |
C12Br8O2 |
| Molecular Weight |
815.3592 |
| InChI |
InChI=1/C12Br8O2/c13-1-2(14)6(18)10-9(5(1)17)21-11-7(19)3(15)4(16)8(20)12(11)22-10 |
| CAS Registry Number |
2170-45-8 |
| Molecular Structure |
|
| Density |
2.936g/cm3 |
| Boiling point |
610.3°C at 760 mmHg |
| Refractive index |
1.757 |
| Flash point |
258.3°C |
| Vapour Pressur |
3.5E-14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|