product Name |
N-Methyl-o-toluamide |
Synonyms |
N-Methyl-2-toluamide; AI3-30032; Benzamide, N,2-dimethyl-; N,2-dimethylbenzamide |
Molecular Formula |
C9H11NO |
Molecular Weight |
149.1897 |
InChI |
InChI=1/C9H11NO/c1-7-5-3-4-6-8(7)9(11)10-2/h3-6H,1-2H3,(H,10,11) |
CAS Registry Number |
2170-09-4 |
EINECS |
218-519-8 |
Molecular Structure |
|
Density |
1.021g/cm3 |
Melting point |
74-77℃ |
Boiling point |
278.3°C at 760 mmHg |
Refractive index |
1.524 |
Flash point |
158.5°C |
Vapour Pressur |
0.00429mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|