| product Name |
Itaconic Anhydride |
| Synonyms |
2-Methylenesuccinic anhydride; 3-methylidenedihydrofuran-2,5-dione |
| Molecular Formula |
C10H10O7 |
| Molecular Weight |
242.1822 |
| InChI |
InChI=1/C10H10O7/c1-5(3-7(11)12)9(15)17-10(16)6(2)4-8(13)14/h1-4H2,(H,11,12)(H,13,14) |
| CAS Registry Number |
2170-03-8 |
| EINECS |
218-518-2 |
| Molecular Structure |
|
| Melting point |
66-70℃ |
| Refractive index |
1.517 |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S24/25:;
|
|