product Name |
2,3-Naphthalenedicarboxylic acid |
Synonyms |
NSC 16063; naphthalene-2,3-dicarboxylic acid; naphthalene-2,3-dicarboxylate |
Molecular Formula |
C12H6O4 |
Molecular Weight |
214.1747 |
InChI |
InChI=1/C12H8O4/c13-11(14)9-5-7-3-1-2-4-8(7)6-10(9)12(15)16/h1-6H,(H,13,14)(H,15,16)/p-2 |
CAS Registry Number |
2169-87-1 |
EINECS |
218-517-7 |
Molecular Structure |
|
Melting point |
238-242℃ |
Boiling point |
407.5°C at 760 mmHg |
Flash point |
214.4°C |
Vapour Pressur |
2.27E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|